# Dynamic Polymer Generation This guide explains how to generate polymer chains on-the-fly from raw monomer SMILES strings, eliminating the need for pre-built polymer SDF files. :::{admonition} Environment Setup :class: tip All commands below assume you have activated the PolyzyMD pixi environment: ```bash pixi shell -e build ``` Alternatively, prefix each command with `pixi run -e build`. ::: ## Overview PolyzyMD supports two modes for polymer generation: | Mode | Description | Use Case | |------|-------------|----------| | **Cached** (default) | Load pre-built polymers from SDF files | Reproducibility, specific sequences | | **Dynamic** | Generate polymers from monomer SMILES | Flexibility, new monomers, rapid prototyping | Dynamic mode uses **ATRP (Atom-Transfer Radical Polymerization)** chemistry to: 1. Activate raw monomer SMILES via initiation reactions 2. Generate all possible polymer fragments 3. Build complete polymer chains with proper termination 4. Assign partial charges automatically ## When to Use Dynamic Mode **Use Dynamic Mode when:** - You want to test new monomer chemistries quickly - You don't have pre-built polymer SDF files - You want the system to handle fragment generation automatically **Use Cached Mode when:** - You need exact reproducibility of polymer structures - You have validated, pre-built polymer SDFs - You're running production simulations with known good structures --- ## Quick Start Here's a minimal configuration for dynamic polymer generation: ```yaml name: "dynamic_polymer_test" enzyme: name: "MyEnzyme" pdb_path: "structures/enzyme.pdb" polymers: enabled: true generation_mode: "dynamic" # Enable dynamic generation type_prefix: "SBMA-EGPMA" monomers: - label: "A" probability: 0.7 name: "SBMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])[N+](C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])S(=O)(=O)[O-])C([H])([H])[H]" - label: "B" probability: 0.3 name: "EGPMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])Oc1c([H])c([H])c([H])c([H])c1[H])C([H])([H])[H]" length: 5 count: 2 charger: "nagl" # ... rest of configuration (solvent, thermodynamics, etc.) ``` Then build and run: ```bash polyzymd build -c config.yaml polyzymd run-segment -c config.yaml -r 1 ``` --- ## Configuration Reference ### Generation Mode ```yaml polymers: generation_mode: "dynamic" # or "cached" (default) ``` | Value | Description | |-------|-------------| | `cached` | Load polymers from pre-built SDF files (default) | | `dynamic` | Generate polymers from monomer SMILES using ATRP chemistry | ### Monomer SMILES In dynamic mode, each monomer requires a `smiles` field: ```yaml monomers: - label: "A" probability: 0.7 name: "SBMA" smiles: "[H]C([H])=C(C(=O)..." # Raw methacrylate SMILES residue_name: "SBM" # Optional: 3-letter residue name ``` | Field | Required | Description | |-------|----------|-------------| | `label` | Yes | Single character identifier (A, B, C...) | | `probability` | Yes | Selection probability (must sum to 1.0) | | `name` | Yes | Monomer name for identification | | `smiles` | Yes (dynamic) | Raw monomer SMILES string | | `residue_name` | No | 3-letter residue name (auto-generated if not provided) | ```{important} **SMILES Format**: Provide the raw, unactivated monomer SMILES. For methacrylates, this means the structure with the C=C double bond intact. The system will handle activation (chlorination) automatically. ``` ### ATRP Reaction Configuration By default, PolyzyMD uses bundled ATRP reaction templates. You can also specify custom reaction files: ```yaml polymers: generation_mode: "dynamic" reactions: initiation: "default" # Use bundled template polymerization: "default" # Use bundled template termination: "default" # Use bundled template # Or specify custom reaction files: # reactions: # initiation: "/path/to/my_initiation.rxn" # polymerization: "/path/to/my_polymerization.rxn" # termination: "/path/to/my_termination.rxn" ``` ### Charge Assignment ```yaml polymers: charger: "nagl" # Charge method for polymer atoms ``` | Method | Description | Speed | |--------|-------------|-------| | `nagl` | Graph neural network charges (recommended) | Fast | | `espaloma` | Machine learning charges | Medium | | `am1bcc` | Semi-empirical QM charges | Slow | ### Retry Configuration Dynamic generation may occasionally produce structures with ring-piercing artifacts. The system automatically retries: ```yaml polymers: max_retries: 10 # Maximum attempts before failing (default: 10) ``` --- ## Complete Example Configuration Here's a complete configuration for running a simulation with dynamically generated polymers: ```yaml name: "LipA_dynamic_polymer_simulation" description: "Lipase A with dynamically generated SBMA-EGPMA copolymers" # Enzyme enzyme: name: "LipA" pdb_path: "structures/enzyme.pdb" # Substrate (optional) substrate: name: "ResorufinButyrate" sdf_path: "structures/substrate.sdf" charge_method: "nagl" residue_name: "RBY" # Dynamic Polymer Generation polymers: enabled: true generation_mode: "dynamic" type_prefix: "SBMA-EGPMA" # ATRP reactions (use bundled defaults) reactions: initiation: "default" polymerization: "default" termination: "default" # Monomer definitions with SMILES monomers: - label: "A" probability: 0.7 name: "SBMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])[N+](C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])S(=O)(=O)[O-])C([H])([H])[H]" residue_name: "SBM" - label: "B" probability: 0.3 name: "EGPMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])Oc1c([H])c([H])c([H])c([H])c1[H])C([H])([H])[H]" residue_name: "EGM" # Chain parameters length: 5 count: 2 # Charge assignment charger: "nagl" max_retries: 10 # Caching cache_directory: ".polymer_cache" # Solvent solvent: primary: type: "water" model: "tip3p" co_solvents: - name: "dmso" mole_fraction: 0.10 residue_name: "DMS" ions: neutralize: true nacl_concentration: 0.0 box: padding: 1.2 shape: "rhombic_dodecahedron" target_density: 1.05 tolerance: 2.0 # Thermodynamics thermodynamics: temperature: 300.0 pressure: 1.0 # Simulation phases simulation_phases: equilibration_stages: - name: "heating" duration: 0.2 samples: 20 ensemble: "NVT" temperature_start: 60.0 temperature_end: 300.0 temperature_increment: 1.0 temperature_interval: 1200.0 position_restraints: - group: "protein_heavy" force_constant: 4184.0 - group: "polymer_heavy" force_constant: 4184.0 - name: "free_equilibration" duration: 0.8 samples: 80 ensemble: "NPT" temperature: 300.0 production: ensemble: "NPT" duration: 100.0 samples: 2500 time_step: 2.0 thermostat: "LangevinMiddle" thermostat_timescale: 1.0 barostat: "MC" barostat_frequency: 25 # Output output: projects_directory: "." scratch_directory: null job_scripts_subdir: "job_scripts" slurm_logs_subdir: "slurm_logs" naming_template: "{enzyme}_{polymer_type}_dynamic_run{replicate}" save_checkpoint: true save_state_data: true trajectory_format: "dcd" ``` --- ## How Dynamic Generation Works ### Step 1: Fragment Generation When you run a simulation with `generation_mode: "dynamic"`, the system: 1. **Loads raw monomer SMILES** from your configuration 2. **Runs initiation reactions** to activate the monomers (chlorination for ATRP) 3. **Runs polymerization reactions** to enumerate all possible fragments 4. **Runs termination reactions** on 1-site fragments to restore terminal alkenes 5. **Creates a MonomerGroup** with named fragments (e.g., `SBMA_2-site`, `SBMA_1-site`) ### Step 2: Polymer Building For each polymer chain: 1. **Generate random sequence** based on monomer probabilities (e.g., "AABBA") 2. **Set terminal orientations** (head/tail use 1-site fragments) 3. **Build 3D structure** using Polymerist's `build_linear_polymer()` 4. **Validate no ring-piercing** (retry if necessary) 5. **Assign partial charges** using the configured charger ### Step 3: Caching Generated fragments and polymers are cached for reuse: ``` .polymer_cache/ ├── SBMA-EGPMA_monomer_group.json # Fragment definitions ├── SBMA-EGPMA_AABBA_5-mer_charged.sdf # Charged polymer structures └── ... ``` To regenerate from scratch, delete the cache: ```bash rm -rf .polymer_cache ``` --- ## Supported Chemistries ### ATRP (Atom-Transfer Radical Polymerization) Currently, dynamic generation supports **methacrylate-based monomers** using ATRP chemistry: - Sulfobetaine methacrylate (SBMA) - Ethylene glycol phenyl ether methacrylate (EGPMA) - Trimethylammonium ethyl methacrylate (TMAEMA) - Sulfopropyl methacrylate (SPMA) - Oligo(ethylene glycol) methacrylate (OEGMA) ### Adding New Monomers To use a new methacrylate monomer: 1. Obtain the SMILES string (with C=C double bond intact) 2. Add it to your configuration: ```yaml monomers: - label: "C" probability: 0.1 name: "MyNewMonomer" smiles: "[H]C([H])=C(C(=O)O...)C([H])([H])[H]" ``` ```{note} For non-methacrylate monomers or different polymerization chemistries (e.g., ring-opening, condensation), you would need to provide custom reaction files. This is an advanced use case. ``` --- ## Troubleshooting ### "No 1-site terminal fragment found for monomer" **Cause**: The cached MonomerGroup has old fragment names. **Solution**: Delete the cache and regenerate: ```bash rm -rf .polymer_cache ``` ### "Failed to build polymer after N attempts due to ring-piercing" **Cause**: The polymer structure has atoms passing through rings. **Solutions**: 1. Increase `max_retries` (default is 10) 2. Try shorter polymer chains 3. Check that monomer SMILES are correct ### "Symbol 'X' not present in monomer group mapping" **Cause**: Mismatch between sequence labels and MonomerGroup fragments. **Solution**: Ensure all monomer labels (A, B, C...) in your config have corresponding fragments generated. Delete the cache and regenerate. ### Slow fragment generation **Cause**: First run generates all fragments, which can take time. **Solution**: This is normal for the first run. Subsequent runs use the cached MonomerGroup and are much faster. --- ## Performance Tips 1. **Start small**: Test with short chains (length: 3-5) and few polymers (count: 1-2) first 2. **Use NAGL charger**: It's much faster than AM1BCC for polymer charging 3. **Reuse cache**: Keep `.polymer_cache` between runs for the same monomer set 4. **Parallelize later**: Dynamic generation currently runs sequentially; HPC parallelization is planned --- ## See Also - {doc}`polymers` - General polymer configuration guide - {doc}`../reference/configuration` - Complete configuration reference - {doc}`gromacs_export` - Running with GROMACS