# GROMACS Export and Simulation This guide explains how to run PolyzyMD simulations using GROMACS instead of the default OpenMM backend. ## Overview PolyzyMD can export your simulation system to GROMACS format, allowing you to: - Run simulations on HPC clusters where GROMACS is preferred - Use GROMACS-specific analysis tools - Leverage GROMACS performance optimizations - Integrate with existing GROMACS workflows The GROMACS export maintains **1:1 parity** with OpenMM simulations using OpenFF force field defaults. --- ## When to Use GROMACS vs OpenMM | Feature | OpenMM | GROMACS | |---------|--------|---------| | **GPU acceleration** | Excellent | Excellent | | **HPC availability** | Less common | Very common | | **Analysis tools** | MDTraj, MDAnalysis | Built-in + MDAnalysis | | **Restart/checkpoint** | Native in PolyzyMD | Standard .cpt files | | **Daisy-chain jobs** | Built-in support | Manual or script-based | | **Learning curve** | Simpler | More complex | **Use GROMACS when:** - Your HPC cluster has optimized GROMACS installations - You need GROMACS-specific analysis tools - You want to integrate with existing GROMACS workflows - You prefer GROMACS file formats (.gro, .xtc, .edr) **Use OpenMM when:** - You want the simplest workflow - You need built-in daisy-chain job management - You're running locally or on a workstation --- ## Quick Start ### Export and Run with GROMACS ```bash # Full workflow: build system + run GROMACS simulation polyzymd run -c config.yaml -r 1 --gromacs # Export files only (for manual execution or HPC submission) polyzymd run -c config.yaml -r 1 --gromacs --dry-run # Build only (export GROMACS files, no simulation) polyzymd build -c config.yaml -r 1 --gromacs ``` ### Using a Custom GROMACS Installation ```bash # Specify custom GROMACS path polyzymd run -c config.yaml --gromacs --gmx-path /usr/local/gromacs/bin/gmx # Or with module system module load gromacs/2023.3 polyzymd run -c config.yaml --gromacs --gmx-path $(which gmx) ``` --- ## Complete Example: Multi-Component System Here's a complete workflow for running a simulation with enzyme, dynamically generated polymers, organic co-solvent, water, and substrate using GROMACS. ### Step 1: Create Configuration ```yaml # config_gromacs.yaml name: "LipA_polymer_gromacs" description: "Lipase A with SBMA-EGPMA polymers in DMS/water - GROMACS" # Enzyme enzyme: name: "LipA" pdb_path: "structures/enzyme.pdb" # Substrate (ligand) substrate: name: "ResorufinButyrate" sdf_path: "structures/substrate.sdf" charge_method: "nagl" residue_name: "RBY" # Dynamic Polymer Generation polymers: enabled: true generation_mode: "dynamic" type_prefix: "SBMA-EGPMA" monomers: - label: "A" probability: 0.7 name: "SBMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])[N+](C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])S(=O)(=O)[O-])C([H])([H])[H]" residue_name: "SBM" - label: "B" probability: 0.3 name: "EGPMA" smiles: "[H]C([H])=C(C(=O)OC([H])([H])C([H])([H])Oc1c([H])c([H])c([H])c([H])c1[H])C([H])([H])[H]" residue_name: "EGM" length: 5 count: 2 charger: "nagl" # Solvent: DMS/water mixture solvent: primary: type: "water" model: "tip3p" co_solvents: - name: "dmso" volume_fraction: 0.30 residue_name: "DMS" ions: neutralize: true nacl_concentration: 0.0 box: padding: 1.2 shape: "rhombic_dodecahedron" target_density: 1.05 tolerance: 2.0 # Thermodynamics thermodynamics: temperature: 300.0 pressure: 1.0 # Simulation phases simulation_phases: equilibration: ensemble: "NVT" duration: 1.0 samples: 100 time_step: 2.0 thermostat: "LangevinMiddle" thermostat_timescale: 1.0 production: ensemble: "NPT" duration: 100.0 samples: 2500 time_step: 2.0 thermostat: "LangevinMiddle" thermostat_timescale: 1.0 barostat: "MC" barostat_frequency: 25 segments: 10 # Output output: projects_directory: "." naming_template: "{enzyme}_{polymer_type}_gromacs_run{replicate}" ``` ### Step 2: Validate Configuration ```bash polyzymd validate -c config_gromacs.yaml ``` ### Step 3: Run with GROMACS ```bash # Full workflow (build + run) polyzymd run -c config_gromacs.yaml -r 1 --gromacs # Or dry-run to just export files polyzymd run -c config_gromacs.yaml -r 1 --gromacs --dry-run ``` --- ## GROMACS Output Files When using `--gromacs`, files are created in `{projects_dir}/replicate_{N}/gromacs/`: ``` gromacs/ ├── {system}.gro # Initial coordinates ├── {system}.top # Topology (includes all molecule types) │ ├── em.mdp # Energy minimization parameters ├── eq_01_nvt.mdp # NVT equilibration (stage 1) ├── eq_02_npt.mdp # NPT equilibration (stage 2, if applicable) ├── prod.mdp # Production MD parameters │ ├── posre_Protein.itp # Position restraints for protein ├── posre_*.itp # Position restraints for other molecules │ ├── run_{system}_gromacs.sh # Generated shell script to run everything │ ├── em.tpr # Energy minimization run input ├── em.gro # Minimized coordinates ├── em.edr # Energy file ├── em.log # Log file │ ├── eq_01.tpr, eq_01.gro, ... # Equilibration outputs ├── eq_02.tpr, eq_02.gro, ... # (if multiple eq stages) │ ├── prod.tpr # Production run input ├── prod.xtc # Production trajectory ├── prod.edr # Production energies ├── prod.gro # Final coordinates ├── prod.cpt # Checkpoint for restart │ ├── prod_nojump.xtc # Trajectory with PBC jumps removed └── prod_centered.xtc # Centered trajectory for visualization ``` --- ## MDP Parameters PolyzyMD generates MDP files that match OpenFF/OpenMM defaults for consistency: ### Key Parameters | Parameter | Value | Notes | |-----------|-------|-------| | `cutoff-scheme` | Verlet | Modern GROMACS default | | `rcoulomb` | 0.9 nm | OpenFF default | | `rvdw` | 0.9 nm | OpenFF default | | `coulombtype` | PME | Particle Mesh Ewald | | `vdwtype` | Cut-off | With potential-shift | | `constraints` | h-bonds | LINCS for hydrogen bonds | | `dt` | 0.002 ps | 2 fs timestep | ### Thermostat/Barostat The MDP parameters are generated based on your config: ```yaml simulation_phases: production: thermostat: "LangevinMiddle" # Maps to sd integrator thermostat_timescale: 1.0 # tau_t = 1.0 ps barostat: "MC" # Maps to Parrinello-Rahman barostat_frequency: 25 # nstpcouple ``` --- ## Generated Run Script The `run_{system}_gromacs.sh` script automates the entire workflow: ```bash #!/bin/bash # Generated by PolyzyMD # Run GROMACS simulation for: LipA_SBMA-EGPMA_gromacs_run1 GMX="${GMX:-gmx}" set -e # Exit on error # Energy minimization $GMX grompp -f em.mdp -c LipA_SBMA-EGPMA_gromacs_run1.gro -p LipA_SBMA-EGPMA_gromacs_run1.top -o em.tpr $GMX mdrun -deffnm em -v # Equilibration stage 1 (NVT) $GMX grompp -f eq_01_nvt.mdp -c em.gro -p LipA_SBMA-EGPMA_gromacs_run1.top -r em.gro -o eq_01.tpr $GMX mdrun -deffnm eq_01 -v # Equilibration stage 2 (NPT) - if applicable $GMX grompp -f eq_02_npt.mdp -c eq_01.gro -p LipA_SBMA-EGPMA_gromacs_run1.top -r em.gro -o eq_02.tpr $GMX mdrun -deffnm eq_02 -v # Production $GMX grompp -f prod.mdp -c eq_02.gro -p LipA_SBMA-EGPMA_gromacs_run1.top -o prod.tpr $GMX mdrun -deffnm prod -v # Post-processing echo "System" | $GMX trjconv -s prod.tpr -f prod.xtc -o prod_nojump.xtc -pbc nojump echo "System" | $GMX trjconv -s prod.tpr -f prod_nojump.xtc -o prod_centered.xtc -center -pbc mol echo "Simulation complete!" ``` You can customize this script or use it as a template for HPC submission. --- ## Running on HPC Clusters ### Manual SLURM Submission After exporting with `--dry-run`, create a SLURM script: ```bash #!/bin/bash #SBATCH --job-name=LipA_gmx #SBATCH --partition=aa100 #SBATCH --nodes=1 #SBATCH --ntasks=1 #SBATCH --cpus-per-task=8 #SBATCH --gres=gpu:1 #SBATCH --time=24:00:00 #SBATCH --output=slurm_%j.out module load gromacs/2023.3 cd /path/to/replicate_1/gromacs # Set GMX environment variable for the run script export GMX=$(which gmx) # Run the generated script bash run_LipA_SBMA-EGPMA_gromacs_run1.sh ``` ### Using GPU Acceleration GROMACS GPU acceleration is configured via environment variables: ```bash # Use GPU for non-bonded and PME export GMX_GPU_DD_COMMS=1 export GMX_GPU_PME_PP_COMMS=1 export GMX_FORCE_UPDATE_DEFAULT_GPU=1 $GMX mdrun -deffnm prod -v -nb gpu -pme gpu -bonded gpu ``` --- ## Troubleshooting ### "GROMACS executable not found" **Cause**: `gmx` command not in PATH. **Solutions**: ```bash # Option 1: Load module module load gromacs # Option 2: Specify path explicitly polyzymd run -c config.yaml --gromacs --gmx-path /opt/gromacs/bin/gmx # Option 3: Add to PATH export PATH=$PATH:/opt/gromacs/bin ``` ### "grompp warnings about charge groups" **Cause**: OpenFF generates systems without charge groups. **Solution**: This is expected and safe to ignore. GROMACS works fine with Verlet cutoff scheme. ### "Fatal error: Number of atoms in [file] does not match" **Cause**: Topology/coordinate mismatch, often from interrupted build. **Solution**: Rebuild from scratch: ```bash rm -rf replicate_*/gromacs/ polyzymd run -c config.yaml --gromacs ``` ### "Simulation crashes during equilibration" **Cause**: Initial structure has clashes or bad contacts. **Solutions**: 1. Use longer/more aggressive energy minimization 2. Increase box padding 3. Check your input structures for issues ### "Trajectory has broken molecules" **Cause**: PBC artifacts in raw trajectory. **Solution**: Use the post-processed trajectories: - `prod_nojump.xtc` - Molecules don't jump across boundaries - `prod_centered.xtc` - System centered, good for visualization --- ## Post-Processing and Analysis ### Extract Energy Data ```bash # Extract temperature echo "Temperature" | gmx energy -f prod.edr -o temperature.xvg # Extract pressure echo "Pressure" | gmx energy -f prod.edr -o pressure.xvg # Extract potential energy echo "Potential" | gmx energy -f prod.edr -o potential.xvg ``` ### Trajectory Analysis ```bash # RMSD of protein echo "Backbone Backbone" | gmx rms -s prod.tpr -f prod_centered.xtc -o rmsd.xvg # RMSF per residue echo "Backbone" | gmx rmsf -s prod.tpr -f prod_centered.xtc -o rmsf.xvg -res # Radius of gyration echo "Protein" | gmx gyrate -s prod.tpr -f prod_centered.xtc -o gyrate.xvg ``` ### Visualize with VMD ```bash vmd replicate_1/gromacs/prod.gro replicate_1/gromacs/prod_centered.xtc ``` --- ## Comparison with OpenMM Output | Metric | OpenMM | GROMACS | Notes | |--------|--------|---------|-------| | Coordinates | `.pdb` | `.gro` | Both readable by MDAnalysis | | Trajectory | `.dcd` | `.xtc` | XTC is compressed | | Energies | state_data.csv | `.edr` | Use `gmx energy` to extract | | Checkpoint | `.xml` | `.cpt` | For restarts | | Topology | `.xml` | `.top` | Different formats | --- ## See Also - {doc}`cli_reference` - Complete CLI documentation including GROMACS options - {doc}`dynamic_polymers` - Dynamic polymer generation - {doc}`configuration` - Configuration file reference - {doc}`quickstart` - Getting started guide